What is the name of the following compound: CH2=CH-CH(OH)-CH2-CH2-CH3? |
Hex-5-en-4-ol Hex-1-en-3-ol Hex-6-en-4-ol None of the above |
Hex-1-en-3-ol |
In the compound: CH2=CH-CH(OH)-CH2-CH2-CH3 (i) The longest chain has 6 carbon atoms so the parent chain is hexane. (ii) The numbering will start from the side of the double bond as the -OH group gets the locant 3. (iii) The double bond gets the locant 1. So, the name of the compound is Hex-1-en-3-ol. |