What is the name of the following compound: CH2=CH-CH(OH)-CH2-CH2-CH3?
Answer & explanation
Correct answer: option 2
In the compound: CH2=CH-CH(OH)-CH2-CH2-CH3
(i) The longest chain has 6 carbon atoms so the parent chain is hexane.
(ii) The numbering will start from the side of the double bond as the -OH group gets the locant 3.
(iii) The double bond gets the locant 1.
So, the name of the compound is Hex-1-en-3-ol.