What is the IUPAC name of the given compound: CH3-CH(Cl)-CH(CH3)-CH(CH3)-CH2OH?
Answer & explanation
Correct answer: option 1
In the given compound :CH3-CH(Cl)-CH(CH3)-CH(CH3)-CH2OH
(i) the longest chain contains 5 carbon atoms so the base compound is pentane
(ii) considering -OH containing carbon as the 1st carbon we give the numbering to the substituents
(iii) Cl is at the 4th position, and the two methyl groups at the 2nd and 3rd position respectively.
So, from this we can derive the name of the compound as:4-Chloro-2,3-dimethylpentan-1-ol.