The correct IUPAC name of the following organic compound is

The correct answer is Option (3) → 4-Bromo-3-methylheptanal

In naming an aldehyde, the –CHO carbon is part of the main chain and is always C1; its position is not written in the name, and the suffix is “-al”. Substituents are then numbered from that end and written in alphabetical order.

The compound is:

    \( \displaystyle \ce{CH3CH2CH2-CH(Br)-CH(CH3)-CH2-CHO} \)

The longest chain containing the –CHO carbon has seven carbons (heptanal). Numbering from the CHO carbon (C1): C2 is \( \ce{CH2} \), C3 carries the methyl group and C4 carries the bromine. Bromo comes before methyl in the alphabet, so the name is 4-bromo-3-methylheptanal.